ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,3-heptanedione |
|
Nazwa produktu: | 2,3-heptanedione |
Angielska nazwa | 2,3-heptanedione;2,3-Heptanedione;Acetyl pentanoyl;Acetyl valeryl;FEMA No. 2543;NSC 31668;UNII-DK55DDE86P;Valerylacetyl;heptane-2,3-dione |
MF | C7H12O2 |
Masie cząsteczkowej | 128.169 |
InChI | InChI=1/C7H12O2/c1-3-4-5-7(9)6(2)8/h3-5H2,1-2H3 |
Nr CAS | 96-04-8 |
EINECS | 202-472-5 |
Struktury molekularnej | |
Gęstość | 0.926g/cm3 |
Temperatura wrzenia | 149.7°C at 760 mmHg |
Współczynnik załamania | 1.413 |
Temperatura zapłonu | 45°C |
Ciśnienie pary | 3.98mmHg at 25°C |
Kody ryzyka | R10##Flammable.:; |
Bezpieczeństwo opis | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |