ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,5-Dimethylbenzothiazole |
|
Nazwa produktu: | 2,5-Dimethylbenzothiazole |
Angielska nazwa | 2,5-Dimethylbenzothiazole;Benzothiazole, 2,5-dimethyl-;2,5-Dimethylbenzthiazol;2,5-Dimethylbenzthiazol [Czech];4-27-00-01101 (Beilstein Handbook Reference);BRN 0116455;2,5-dimethyl-1,3-benzothiazole |
MF | C9H9NS |
Masie cząsteczkowej | 163.2395 |
InChI | InChI=1/C9H9NS/c1-6-3-4-9-8(5-6)10-7(2)11-9/h3-5H,1-2H3 |
Nr CAS | 95-26-1 |
EINECS | 202-404-4 |
Struktury molekularnej | |
Gęstość | 1.176g/cm3 |
Temperatura topnienia | 36-40℃ |
Temperatura wrzenia | 259.4°C at 760 mmHg |
Współczynnik załamania | 1.643 |
Temperatura zapłonu | 112.7°C |
Ciśnienie pary | 0.021mmHg at 25°C |
Symbole zagrożenia | Xn##Harmful:; |
Kody ryzyka | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |