ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94-32-6 ethyl 4-(butylamino)benzoate |
|
Nazwa produktu: | ethyl 4-(butylamino)benzoate |
Angielska nazwa | ethyl 4-(butylamino)benzoate;Ethyl 4-(n-butylamino)benzoate;4-(n-Butylamino)benzoic acid ethyl ester;Ethyl-4-n-butylamino-benzoate |
MF | C13H19NO2 |
Masie cząsteczkowej | 221.2955 |
InChI | InChI=1/C13H19NO2/c1-3-5-10-14-12-8-6-11(7-9-12)13(15)16-4-2/h6-9,14H,3-5,10H2,1-2H3 |
Nr CAS | 94-32-6 |
EINECS | 202-322-9 |
Struktury molekularnej | |
Gęstość | 1.039g/cm3 |
Temperatura topnienia | 68-70℃ |
Temperatura wrzenia | 338.4°C at 760 mmHg |
Współczynnik załamania | 1.534 |
Temperatura zapłonu | 158.4°C |
Ciśnienie pary | 9.87E-05mmHg at 25°C |
Bezpieczeństwo opis | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |