ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
92-24-0 2,3-Benzanthracene |
|
Nazwa produktu: | 2,3-Benzanthracene |
Angielska nazwa | 2,3-Benzanthracene;NAPHTHACENE;Chrysogen;LT-S940;Tetracene |
MF | C18H12 |
Masie cząsteczkowej | 228.2879 |
InChI | InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
Nr CAS | 92-24-0 |
EINECS | 202-138-9 |
Struktury molekularnej | |
Gęstość | 1.19g/cm3 |
Temperatura topnienia | 300℃ |
Temperatura wrzenia | 436.7°C at 760 mmHg |
Współczynnik załamania | 1.771 |
Temperatura zapłonu | 209.1°C |
Ciśnienie pary | 2.02E-07mmHg at 25°C |
Symbole zagrożenia | Xn##Harmful:; |
Kody ryzyka | R40##Possible risks of irreversible effects.:; |
Bezpieczeństwo opis | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |