ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-35-0 3,5-Dihydroxy-2-naphthalenecarboxylic acid |
|
Nazwa produktu: | 3,5-Dihydroxy-2-naphthalenecarboxylic acid |
Angielska nazwa | 3,5-Dihydroxy-2-naphthalenecarboxylic acid;3,5-Dihydroxy-2-naphthoic acid;3,5-dihydroxynaphthalene-2-carboxylic acid;3,5-dihydroxynaphthalene-2-carboxylate |
MF | C11H7O4 |
Masie cząsteczkowej | 203.1714 |
InChI | InChI=1/C11H8O4/c12-9-3-1-2-6-4-8(11(14)15)10(13)5-7(6)9/h1-5,12-13H,(H,14,15)/p-1 |
Nr CAS | 89-35-0 |
EINECS | 201-900-8 |
Struktury molekularnej | |
Temperatura topnienia | 275-280℃ |
Temperatura wrzenia | 442.2°C at 760 mmHg |
Temperatura zapłonu | 235.3°C |
Ciśnienie pary | 1.35E-08mmHg at 25°C |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |