ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88196-70-7 (R)-1-(3-Methoxyphenyl)ethylamine |
|
Nazwa produktu: | (R)-1-(3-Methoxyphenyl)ethylamine |
Angielska nazwa | (R)-1-(3-Methoxyphenyl)ethylamine;(R)-m-Methoxy-alpha-methylbenzylamine;(1R)-1-(3-methoxyphenyl)ethanamine |
MF | C9H13NO |
Masie cząsteczkowej | 151.2056 |
InChI | InChI=1/C9H13NO/c1-7(10)8-4-3-5-9(6-8)11-2/h3-7H,10H2,1-2H3/t7-/m1/s1 |
Nr CAS | 88196-70-7 |
Struktury molekularnej | |
Gęstość | 1.003g/cm3 |
Temperatura wrzenia | 234.6°C at 760 mmHg |
Współczynnik załamania | 1.522 |
Temperatura zapłonu | 94.7°C |
Ciśnienie pary | 0.0524mmHg at 25°C |
Kody ryzyka | R21/22##Harmful in contact with skin and if swallowed.||R34##Causes burns.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |