ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
phthalamic acid |
|
Nazwa produktu: | phthalamic acid |
Angielska nazwa | phthalamic acid;Phthalamic acid, (2-Carboxybenzamide);2-Carboxybenzamide;2-carbamoylbenzoic acid |
MF | C8H7NO3 |
Masie cząsteczkowej | 165.1461 |
InChI | InChI=1/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12) |
Nr CAS | 88-97-1 |
EINECS | 201-871-1 |
Struktury molekularnej | |
Gęstość | 1.368g/cm3 |
Temperatura wrzenia | 394.2°C at 760 mmHg |
Współczynnik załamania | 1.615 |
Temperatura zapłonu | 192.2°C |
Ciśnienie pary | 6.38E-07mmHg at 25°C |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |