ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-82-1 Hexabromobenzene |
|
Nazwa produktu: | Hexabromobenzene |
Angielska nazwa | Hexabromobenzene;AI3-60220;CCRIS 5917;HSDB 2912;NSC 113975;Benzene, 1,2,3,4,5,6-hexabromo-;Benzene, hexabromo- |
MF | C6Br6 |
Masie cząsteczkowej | 551.49 |
InChI | InChI=1/C6Br6/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
Nr CAS | 87-82-1 |
EINECS | 201-773-9 |
Struktury molekularnej | ![]() |
Temperatura topnienia | 326-327℃ |
Symbole zagrożenia | |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S24/25##Avoid contact with skin and eyes.:; |
MSDS |