ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-52-5 Gramine |
|
Nazwa produktu: | Gramine |
Angielska nazwa | Gramine;3-(Dimethylaminomethyl)indole;(1H-Indol-3-ylmethyl)-dimethyl-amine |
MF | C11H14N2 |
Masie cząsteczkowej | 174.2423 |
InChI | InChI=1/C11H14N2/c1-13(2)8-9-7-12-11-6-4-3-5-10(9)11/h3-7,12H,8H2,1-2H3 |
Nr CAS | 87-52-5 |
EINECS | 201-749-8 |
Struktury molekularnej | ![]() |
Gęstość | 1.099g/cm3 |
Temperatura topnienia | 131-139℃ |
Temperatura wrzenia | 293.9°C at 760 mmHg |
Współczynnik załamania | 1.63 |
Temperatura zapłonu | 131.5°C |
Rozpuszczalność w wodzie | PRACTICALLY INSOLUBLE |
Ciśnienie pary | 0.00168mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R36##Irritating to eyes.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S46##If swallowed, seek medical advice immediately and show this container or label.:; |
MSDS |