Chemindex > 79-35-6
PL ▼
79-35-6 1,1-dichloro-2,2-difluoroethylene |
|
| Nazwa produktu: | 1,1-dichloro-2,2-difluoroethylene |
| Angielska nazwa | 1,1-dichloro-2,2-difluoroethylene;FC-1112a;1-chloro-1,2,2-trifluoroethene |
| MF | C2Cl2F2 |
| Masie cząsteczkowej | 132.9242 |
| InChI | InChI=1/C2Cl2F2/c3-1(4)2(5)6 |
| Nr CAS | 79-35-6 |
| EINECS | 201-198-3 |
| Struktury molekularnej |  |
| Gęstość | 1.503g/cm3 |
| Temperatura wrzenia | 17.3°C at 760 mmHg |
| Współczynnik załamania | 1.392 |
| Ciśnienie pary | 999mmHg at 25°C |
| Kody ryzyka | R23##Toxic by inhalation.||R36/38##Irritating to eyes and skin.:; |
| Bezpieczeństwo opis | S23##Do not inhale gas/fumes/vapour/spray.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S9##Keep container in a well-ventilated place.:; |
| MSDS | |
- Jeśli planujesz zaopatrywać się w chemikalia z Chin, po prostu udaj się do centrum handlowego ChemNet, a my uzyskamy dla Ciebie najnowszą i konkurencyjną cenę od chińskich producentów.Odwiedź stronę
ChemNet Mall
Usługa bazy danych Chemical CAS jest świadczona przez ChemIndex.com 