ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75-27-4 Bromodichloromethane |
|
Nazwa produktu: | Bromodichloromethane |
Angielska nazwa | Bromodichloromethane;FC-20B1 |
MF | CHBrCl2 |
Masie cząsteczkowej | 163.8286 |
InChI | InChI=1/CHBrCl2/c2-1(3)4/h1H |
Nr CAS | 75-27-4 |
EINECS | 200-856-7 |
Struktury molekularnej | |
Gęstość | 2.013g/cm3 |
Temperatura topnienia | -55℃ |
Temperatura wrzenia | 89.7°C at 760 mmHg |
Współczynnik załamania | 1.503 |
Temperatura zapłonu | 1.3°C |
Ciśnienie pary | 65.3mmHg at 25°C |
Symbole zagrożenia | Xn##Harmful:; |
Kody ryzyka | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
Bezpieczeństwo opis | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |