ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
9-chloroanthracene |
|
Nazwa produktu: | 9-chloroanthracene |
Angielska nazwa | 9-chloroanthracene;Anthracene, 9-chloro-;9-Chloroanthracene;CCRIS 5547 |
MF | C14H9Cl |
Masie cząsteczkowej | 212.6743 |
InChI | InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
Nr CAS | 716-53-0 |
EINECS | 211-937-1 |
Struktury molekularnej | |
Gęstość | 1.253g/cm3 |
Temperatura topnienia | 103-103℃ |
Temperatura wrzenia | 370.1°C at 760 mmHg |
Współczynnik załamania | 1.717 |
Temperatura zapłonu | 179.2°C |
Ciśnienie pary | 2.42E-05mmHg at 25°C |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |