ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Bis(2-thienyl) ketone |
|
Nazwa produktu: | Bis(2-thienyl) ketone |
Angielska nazwa | Bis(2-thienyl) ketone;Di-2-thienyl ketone;Bis(2-thienyl)ketone~Di-2-thienyl ketone;dithiophen-2-ylmethanone |
MF | C9H6OS2 |
Masie cząsteczkowej | 194.2733 |
InChI | InChI=1/C9H6OS2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h1-6H |
Nr CAS | 704-38-1 |
Struktury molekularnej | |
Gęstość | 1.326g/cm3 |
Temperatura topnienia | 89-91℃ |
Temperatura wrzenia | 323°C at 760 mmHg |
Współczynnik załamania | 1.64 |
Temperatura zapłonu | 149.1°C |
Ciśnienie pary | 0.00027mmHg at 25°C |
Bezpieczeństwo opis | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |