ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
617-36-7 Ethyl oxamate |
|
Nazwa produktu: | Ethyl oxamate |
Angielska nazwa | Ethyl oxamate;oxamethane;Oxamic acid ethyl ester;ethyl amino(oxo)acetate |
MF | C4H7NO3 |
Masie cząsteczkowej | 117.1033 |
InChI | InChI=1/C4H7NO3/c1-2-8-4(7)3(5)6/h2H2,1H3,(H2,5,6) |
Nr CAS | 617-36-7 |
EINECS | 210-512-8 |
Struktury molekularnej | |
Gęstość | 1.184g/cm3 |
Temperatura topnienia | 112-115℃ |
Temperatura wrzenia | 188.7°C at 760 mmHg |
Współczynnik załamania | 1.437 |
Temperatura zapłonu | 87°C |
Ciśnienie pary | 0.59mmHg at 25°C |
Bezpieczeństwo opis | S24/25##Avoid contact with skin and eyes.:; |
MSDS |