ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Chloro-5-methylphenol |
|
Nazwa produktu: | 2-Chloro-5-methylphenol |
Angielska nazwa | 2-Chloro-5-methylphenol;4-Chloro-3-hydroxytoluene; 6-chloro-m-cresol |
MF | C7H7ClO |
Masie cząsteczkowej | 142.58 |
InChI | InChI=1/C7H7ClO/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,1H3 |
Nr CAS | 615-74-7 |
EINECS | 210-444-9 |
Struktury molekularnej | |
Gęstość | 1.215 |
Temperatura topnienia | 45-48℃ |
Temperatura wrzenia | 196℃ |
Temperatura zapłonu | 81℃ |
Symbole zagrożenia | Xn##Harmful:; |
Kody ryzyka | R21/22##Harmful in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |