ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
613-80-9 di-2-naphthyl ether |
|
Nazwa produktu: | di-2-naphthyl ether |
Angielska nazwa | di-2-naphthyl ether;Dinaphthylether;2,2-Dinaphthyl ether;2-Naphthyl ether;2,2'-oxydinaphthalene |
MF | C20H14O |
Masie cząsteczkowej | 270.3246 |
InChI | InChI=1/C20H14O/c1-3-7-17-13-19(11-9-15(17)5-1)21-20-12-10-16-6-2-4-8-18(16)14-20/h1-14H |
Nr CAS | 613-80-9 |
EINECS | 210-356-0 |
Struktury molekularnej | ![]() |
Gęstość | 1.184g/cm3 |
Temperatura wrzenia | 449.9°C at 760 mmHg |
Współczynnik załamania | 1.701 |
Temperatura zapłonu | 226.1°C |
Ciśnienie pary | 7.3E-08mmHg at 25°C |
Bezpieczeństwo opis | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |