Chemindex > 612-28-2
PL ▼
612-28-2 N-Methyl-2-nitroaniline |
|
| Nazwa produktu: | N-Methyl-2-nitroaniline |
| Angielska nazwa | N-Methyl-2-nitroaniline;Benzenamine, N-methyl-2-nitro-;2-Nitro-N-methylaniline;4-12-00-01564 (Beilstein Handbook Reference);Aniline, N-methyl-o-nitro-;BRN 2209110;N-Methyl-2-nitrobenzenamine;N-Methyl-o-nitroaniline;NSC 86672;o-(Methylamino)nitrobenzene;o-Nitro-N-methylaniline |
| MF | C7H8N2O2 |
| Masie cząsteczkowej | 152.1506 |
| InChI | InChI=1/C7H8N2O2/c1-8-6-4-2-3-5-7(6)9(10)11/h2-5,8H,1H3 |
| Nr CAS | 612-28-2 |
| EINECS | 210-303-1 |
| Struktury molekularnej |  |
| Gęstość | 1.26g/cm3 |
| Temperatura topnienia | 33-37℃ |
| Temperatura wrzenia | 277.9°C at 760 mmHg |
| Współczynnik załamania | 1.619 |
| Temperatura zapłonu | 121.9°C |
| Ciśnienie pary | 0.0044mmHg at 25°C |
| Symbole zagrożenia |  T##Toxic:; |
| Kody ryzyka | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
| Bezpieczeństwo opis | S28A##After contact with skin, wash immediately with plenty of water.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jeśli planujesz zaopatrywać się w chemikalia z Chin, po prostu udaj się do centrum handlowego ChemNet, a my uzyskamy dla Ciebie najnowszą i konkurencyjną cenę od chińskich producentów.Odwiedź stronę
ChemNet Mall
Usługa bazy danych Chemical CAS jest świadczona przez ChemIndex.com 