ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
610-69-5 octan 2-nitrofenylu |
|
Nazwa produktu: | octan 2-nitrofenylu |
Synonimy | octan 2-nitrofenylu; ester 2-nitrofenylowy kwasu octowego; |
Angielska nazwa | 2-nitrophenyl acetate;2-Nitrophenyl acetate;Acetic acid 2-nitrophenyl ester |
MF | C8H7NO4 |
Masie cząsteczkowej | 181.1455 |
InChI | InChI=1/C8H7NO4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3 |
Nr CAS | 610-69-5 |
EINECS | 210-233-1 |
Struktury molekularnej | ![]() |
Gęstość | 1.304g/cm3 |
Temperatura topnienia | 39-41℃ |
Temperatura wrzenia | 274.8°C at 760 mmHg |
Współczynnik załamania | 1.548 |
Temperatura zapłonu | 139.8°C |
Ciśnienie pary | 0.00528mmHg at 25°C |
Bezpieczeństwo opis | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |