ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
609-11-0 Ethyl 2,3-dibromobutyrate |
|
Nazwa produktu: | Ethyl 2,3-dibromobutyrate |
Angielska nazwa | Ethyl 2,3-dibromobutyrate;2,3-Dibromobutyric acid ethyl ester;2,3-Dibromo-n-butyric acid ethyl ester;ethyl 2,3-dibromobutanoate |
MF | C6H10Br2O2 |
Masie cząsteczkowej | 273.9504 |
InChI | InChI=1/C6H10Br2O2/c1-3-10-6(9)5(8)4(2)7/h4-5H,3H2,1-2H3 |
Nr CAS | 609-11-0 |
EINECS | 210-177-8 |
Struktury molekularnej | |
Gęstość | 1.731g/cm3 |
Temperatura wrzenia | 226.7°C at 760 mmHg |
Współczynnik załamania | 1.506 |
Temperatura zapłonu | 90.9°C |
Ciśnienie pary | 0.0809mmHg at 25°C |
Kody ryzyka | R34##Causes burns.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |