ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
608-08-2 Indoxyl acetate |
|
Nazwa produktu: | Indoxyl acetate |
Angielska nazwa | Indoxyl acetate;3-Acetoxyindole~Indolyl acetate~Y-acetate;Indoxyl acetate 3-Indoxyl acetate;3-Indolyl acetate;3-Acetoxyindole;1H-indol-3-yl acetate |
MF | C10H9NO2 |
Masie cząsteczkowej | 175.184 |
InChI | InChI=1/C10H9NO2/c1-7(12)13-10-6-11-9-5-3-2-4-8(9)10/h2-6,11H,1H3 |
Nr CAS | 608-08-2 |
EINECS | 210-154-2 |
Struktury molekularnej | ![]() |
Gęstość | 1.255g/cm3 |
Temperatura topnienia | 128-131℃ |
Temperatura wrzenia | 339.1°C at 760 mmHg |
Współczynnik załamania | 1.633 |
Temperatura zapłonu | 158.9°C |
Ciśnienie pary | 9.41E-05mmHg at 25°C |
Bezpieczeństwo opis | S24/25##Avoid contact with skin and eyes.:; |
MSDS |