ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
606-26-8 2-Nitrobenzhydrazide |
|
Nazwa produktu: | 2-Nitrobenzhydrazide |
Angielska nazwa | 2-Nitrobenzhydrazide;2-Nitrobenzoic hydrazide;2-Nitrobenzoyl hydrazide;2-nitrobenzohydrazide |
MF | C7H7N3O3 |
Masie cząsteczkowej | 181.1488 |
InChI | InChI=1/C7H7N3O3/c8-9-7(11)5-3-1-2-4-6(5)10(12)13/h1-4H,8H2,(H,9,11) |
Nr CAS | 606-26-8 |
EINECS | 210-110-2 |
Struktury molekularnej | |
Gęstość | 1.406g/cm3 |
Temperatura topnienia | 123℃ |
Współczynnik załamania | 1.621 |
Symbole zagrożenia | Xi##Irritant:; |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |