ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
605-69-6 Martius Yellow |
|
Nazwa produktu: | Martius Yellow |
Angielska nazwa | Martius Yellow;C.I. 10315;Martius yellow;2,4-Dinitro-1-naphthol;Acid Yellow 24;C.I. 10315~Martius Yellow;2,4-dinitronaphthalen-1-ol;2,4-dinitronaphthalen-1-olate |
MF | C10H5N2O5 |
Masie cząsteczkowej | 233.1576 |
InChI | InChI=1/C10H6N2O5/c13-10-7-4-2-1-3-6(7)8(11(14)15)5-9(10)12(16)17/h1-5,13H/p-1 |
Nr CAS | 605-69-6 |
EINECS | 210-093-1 |
Struktury molekularnej | ![]() |
Temperatura topnienia | 130-133℃ |
Temperatura wrzenia | 407.9°C at 760 mmHg |
Temperatura zapłonu | 179.9°C |
Ciśnienie pary | 3.08E-07mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
Bezpieczeństwo opis | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |