ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
605-02-7 1-Phenylnaphthalene |
|
Nazwa produktu: | 1-Phenylnaphthalene |
Angielska nazwa | 1-Phenylnaphthalene;NSC 5257;Naphthalene, 1-phenyl-;Naphthalene, 1-phenyl- (8CI)(9CI) |
MF | C16H12 |
Masie cząsteczkowej | 204.2665 |
InChI | InChI=1/C16H12/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16/h1-12H |
Nr CAS | 605-02-7 |
EINECS | 210-081-6 |
Struktury molekularnej | ![]() |
Gęstość | 1.081g/cm3 |
Temperatura wrzenia | 336.4°C at 760 mmHg |
Współczynnik załamania | 1.647 |
Temperatura zapłonu | 148.2°C |
Ciśnienie pary | 0.000219mmHg at 25°C |
Bezpieczeństwo opis | S24/25##Avoid contact with skin and eyes.:; |
MSDS |