ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
603-52-1 ethyl diphenylcarbamate |
|
Nazwa produktu: | ethyl diphenylcarbamate |
Angielska nazwa | ethyl diphenylcarbamate; |
MF | C15H15NO2 |
Masie cząsteczkowej | 241.2851 |
InChI | InChI=1/C15H15NO2/c1-2-18-15(17)16(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
Nr CAS | 603-52-1 |
EINECS | 210-047-0 |
Struktury molekularnej | ![]() |
Gęstość | 1.146g/cm3 |
Temperatura topnienia | 70-72℃ |
Temperatura wrzenia | 360°C at 760 mmHg |
Współczynnik załamania | 1.593 |
Temperatura zapłonu | 171.5°C |
Ciśnienie pary | 2.29E-05mmHg at 25°C |
Bezpieczeństwo opis | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |