ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
quinine dihydrochloride |
|
Nazwa produktu: | quinine dihydrochloride |
Angielska nazwa | quinine dihydrochloride;Quinine Dihydochloride;(8alpha,9R)-6'-methoxycinchonan-9-ol dihydrochloride |
MF | C20H26Cl2N2O2 |
Masie cząsteczkowej | 397.3386 |
InChI | InChI=1/C20H24N2O2.2ClH/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;;/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;2*1H/t13-,14-,19-,20+;;/m0../s1 |
Nr CAS | 60-93-5 |
EINECS | 200-493-4 |
Struktury molekularnej | |
Temperatura wrzenia | 495.9°C at 760 mmHg |
Temperatura zapłonu | 253.7°C |
Ciśnienie pary | 1.19E-10mmHg at 25°C |
Kody ryzyka | R22##Harmful if swallowed.||R42/43##May cause sensitization by inhalation and skin contact.:; |
Bezpieczeństwo opis | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |