ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56-53-1 Diethylstilbestrol |
|
Nazwa produktu: | Diethylstilbestrol |
Angielska nazwa | Diethylstilbestrol;Stilboestrol;a,a-Diethyl-4,4-Stilbenediol Carc.;Atovaquone;4,4'-(3E)-hex-3-ene-3,4-diyldiphenol;4,4'-(3Z)-hex-3-ene-3,4-diyldiphenol;diethylstilbestrol, mixture of cis and trans;Diethylstilbestrol,mixture of cis and trans;Diethylstilbestrol BP |
MF | C18H20O2 |
Masie cząsteczkowej | 268.3502 |
InChI | InChI=1/C18H20O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,19-20H,3-4H2,1-2H3/b18-17- |
Nr CAS | 56-53-1;6898-97-1 |
EINECS | 200-278-5 |
Struktury molekularnej | ![]() |
Gęstość | 1.107g/cm3 |
Temperatura topnienia | 169-175℃ |
Temperatura wrzenia | 407.1°C at 760 mmHg |
Współczynnik załamania | 1.603 |
Temperatura zapłonu | 187°C |
Rozpuszczalność w wodzie | PRACTICALLY INSOLUBLE |
Ciśnienie pary | 3.29E-07mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R40||R45||R61||R36/37/38||R51/53:; |
Bezpieczeństwo opis | S36/37/39||S45||S53||S60||S61:; |
MSDS |