ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54376-65-7 4-Diethylaminobenzaldehyde oxime |
|
Nazwa produktu: | 4-Diethylaminobenzaldehyde oxime |
Angielska nazwa | 4-Diethylaminobenzaldehyde oxime;4-Diethylaminobenzaldoxime |
MF | C11H16N2O |
Masie cząsteczkowej | 192.2575 |
InChI | InChI=1/C11H16N2O/c1-3-13(4-2)11-7-5-10(6-8-11)9-12-14/h5-9,14H,3-4H2,1-2H3/b12-9+ |
Nr CAS | 54376-65-7 |
Struktury molekularnej | |
Gęstość | 1g/cm3 |
Temperatura wrzenia | 307.7°C at 760 mmHg |
Współczynnik załamania | 1.517 |
Temperatura zapłonu | 139.9°C |
Ciśnienie pary | 0.000309mmHg at 25°C |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |