ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52805-36-4 4-Benzyloxybenzonitrile |
|
Nazwa produktu: | 4-Benzyloxybenzonitrile |
Angielska nazwa | 4-Benzyloxybenzonitrile; |
MF | C14H11NO |
Masie cząsteczkowej | 209.2432 |
InChI | InChI=1/C14H11NO/c15-10-12-6-8-14(9-7-12)16-11-13-4-2-1-3-5-13/h1-9H,11H2 |
Nr CAS | 52805-36-4 |
Struktury molekularnej | |
Gęstość | 1.14g/cm3 |
Temperatura wrzenia | 374°C at 760 mmHg |
Współczynnik załamania | 1.597 |
Temperatura zapłonu | 157.6°C |
Ciśnienie pary | 8.61E-06mmHg at 25°C |
Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Bezpieczeństwo opis | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |