ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52605-96-6 2-Chloro-3-methoxypyridine |
|
Nazwa produktu: | 2-Chloro-3-methoxypyridine |
Angielska nazwa | 2-Chloro-3-methoxypyridine; |
MF | C6H6ClNO |
Masie cząsteczkowej | 143.5709 |
InChI | InChI=1/C6H6ClNO/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3 |
Nr CAS | 52605-96-6 |
EINECS | 258-039-6 |
Struktury molekularnej | |
Gęstość | 1.21g/cm3 |
Temperatura wrzenia | 210.6°C at 760 mmHg |
Współczynnik załamania | 1.517 |
Temperatura zapłonu | 81.2°C |
Ciśnienie pary | 0.276mmHg at 25°C |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |