ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
tetraiodoethylene |
|
Nazwa produktu: | tetraiodoethylene |
Angielska nazwa | tetraiodoethylene;diiodoform;tetraiodoethene |
MF | C2I4 |
Masie cząsteczkowej | 531.6393 |
InChI | InChI=1/C2I4/c3-1(4)2(5)6 |
Nr CAS | 513-92-8 |
EINECS | 208-176-2 |
Struktury molekularnej | |
Gęstość | 4.087g/cm3 |
Temperatura topnienia | 191-193℃ |
Temperatura wrzenia | 288.3°C at 760 mmHg |
Współczynnik załamania | 1.952 |
Temperatura zapłonu | 139.9°C |
Ciśnienie pary | 0.00409mmHg at 25°C |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |