ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Fluoro-N-methylaniline |
|
Nazwa produktu: | 4-Fluoro-N-methylaniline |
Angielska nazwa | 4-Fluoro-N-methylaniline;4-Fluoro-N-toluidine |
MF | C7H8FN |
Masie cząsteczkowej | 125.1435 |
InChI | InChI=1/C7H8FN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 |
Nr CAS | 459-59-6 |
EINECS | 207-294-1 |
Struktury molekularnej | |
Gęstość | 1.106g/cm3 |
Temperatura wrzenia | 181.4°C at 760 mmHg |
Współczynnik załamania | 1.546 |
Temperatura zapłonu | 63.5°C |
Ciśnienie pary | 0.853mmHg at 25°C |
Symbole zagrożenia | Xi##Irritant:; |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |