ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
459-47-2 1,4-ethylfluorobenzene |
|
Nazwa produktu: | 1,4-ethylfluorobenzene |
Angielska nazwa | 1,4-ethylfluorobenzene;1-Ethyl-4-fluorobenzene;benzene, 1-ethyl-4-fluoro-;Ethyl-4-fluorobenzene |
MF | C8H9F |
Masie cząsteczkowej | 124.1555 |
InChI | InChI=1/C8H9F/c1-2-7-3-5-8(9)6-4-7/h3-6H,2H2,1H3 |
Nr CAS | 459-47-2 |
Struktury molekularnej | ![]() |
Gęstość | 0.981g/cm3 |
Temperatura wrzenia | 141.6°C at 760 mmHg |
Współczynnik załamania | 1.477 |
Temperatura zapłonu | 28.9°C |
Ciśnienie pary | 7.26mmHg at 25°C |
Kody ryzyka | R10##Flammable.:; |
Bezpieczeństwo opis | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |