ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
455-37-8 3-fluorobenzamide |
|
Nazwa produktu: | 3-fluorobenzamide |
Angielska nazwa | 3-fluorobenzamide;m-Fluorobenzamide |
MF | C7H6FNO |
Masie cząsteczkowej | 139.127 |
InChI | InChI=1/C7H6FNO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H2,9,10) |
Nr CAS | 455-37-8 |
EINECS | 207-247-5 |
Struktury molekularnej | ![]() |
Gęstość | 1.238g/cm3 |
Temperatura topnienia | 129-132℃ |
Temperatura wrzenia | 238.4°C at 760 mmHg |
Współczynnik załamania | 1.538 |
Temperatura zapłonu | 98°C |
Ciśnienie pary | 0.0426mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |