ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-Chloro-3-fluoro-2-propanol |
|
Nazwa produktu: | 1-Chloro-3-fluoro-2-propanol |
Angielska nazwa | 1-Chloro-3-fluoro-2-propanol;1-Chloro-3-fluoroisopropanol;1-chloro-3-fluoropropan-2-ol |
MF | C3H6ClFO |
Masie cząsteczkowej | 112.5305 |
InChI | InChI=1/C3H6ClFO/c4-1-3(6)2-5/h3,6H,1-2H2 |
Nr CAS | 453-11-2 |
Struktury molekularnej | |
Gęstość | 1.212g/cm3 |
Temperatura wrzenia | 158.1°C at 760 mmHg |
Współczynnik załamania | 1.399 |
Temperatura zapłonu | 49.4°C |
Ciśnienie pary | 0.951mmHg at 25°C |
Kody ryzyka | R10##Flammable.||R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Bezpieczeństwo opis | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |