ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4463-33-6 2,3-Dimethoxytoluene |
|
Nazwa produktu: | 2,3-Dimethoxytoluene |
Angielska nazwa | 2,3-Dimethoxytoluene;3-Methylveratrole;1,2-dimethoxy-3-methylbenzene |
MF | C9H12O2 |
Masie cząsteczkowej | 152.1904 |
InChI | InChI=1/C9H12O2/c1-7-5-4-6-8(10-2)9(7)11-3/h4-6H,1-3H3 |
Nr CAS | 4463-33-6 |
EINECS | 224-726-4 |
Struktury molekularnej | ![]() |
Gęstość | 0.99g/cm3 |
Temperatura wrzenia | 201.4°C at 760 mmHg |
Współczynnik załamania | 1.489 |
Temperatura zapłonu | 67.6°C |
Ciśnienie pary | 0.438mmHg at 25°C |
Kody ryzyka | R36/38##Irritating to eyes and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |