ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Bromo-5-fluoronitrobenzene |
|
Nazwa produktu: | 2-Bromo-5-fluoronitrobenzene |
Angielska nazwa | 2-Bromo-5-fluoronitrobenzene;1-Bromo-4-fluoro-2-nitrobenzene |
MF | C6H3BrFNO2 |
Masie cząsteczkowej | 219.9959 |
InChI | InChI=1/C6H3BrFNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
Nr CAS | 446-09-3 |
EINECS | 207-160-2 |
Struktury molekularnej | |
Gęstość | 1.808g/cm3 |
Temperatura topnienia | 37-39℃ |
Temperatura wrzenia | 220.9°C at 760 mmHg |
Współczynnik załamania | 1.579 |
Temperatura zapłonu | 87.4°C |
Ciśnienie pary | 0.164mmHg at 25°C |
Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |