ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Chloro-6-fluorobenzaldoxime |
|
Nazwa produktu: | 2-Chloro-6-fluorobenzaldoxime |
Angielska nazwa | 2-Chloro-6-fluorobenzaldoxime;2-Chloro-6-fluorobenzaldehyde oxime |
MF | C7H5ClFNO |
Masie cząsteczkowej | 173.5721 |
InChI | InChI=1/C7H5ClFNO/c8-6-2-1-3-7(9)5(6)4-10-11/h1-4,11H |
Nr CAS | 443-33-4 |
EINECS | 207-135-6 |
Struktury molekularnej | |
Gęstość | 1.32g/cm3 |
Temperatura topnienia | 133℃ |
Temperatura wrzenia | 238°C at 760 mmHg |
Współczynnik załamania | 1.533 |
Temperatura zapłonu | 97.8°C |
Ciśnienie pary | 0.0237mmHg at 25°C |
Symbole zagrożenia | Xi##Irritant:; |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |