Chemindex > 437-17-2
PL ▼
437-17-2 Triphenylcarbenium hexafluorophosphate |
|
| Nazwa produktu: | Triphenylcarbenium hexafluorophosphate |
| Angielska nazwa | Triphenylcarbenium hexafluorophosphate;Trityl hexafluorophosphate;Tritylium hexafluorophosphate;triphenylmethylium hexafluorophosphate |
| Masie cząsteczkowej | 243.3219 |
| InChI | InChI=1/C19H15.F6P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2,3,4,5)6/h1-15H;/q+1;-1 |
| Nr CAS | 437-17-2 |
| EINECS | 207-112-0 |
| Struktury molekularnej |  |
| Temperatura topnienia | 150℃ |
| Symbole zagrożenia |  C##Corrosive:; |
| Kody ryzyka | R20/21##Harmful by inhalation and in contact with skin.||R34##Causes burns.:; |
| Bezpieczeństwo opis | S28##After contact with skin, wash immediately with plenty of ...:; |
| MSDS | |
- Jeśli planujesz zaopatrywać się w chemikalia z Chin, po prostu udaj się do centrum handlowego ChemNet, a my uzyskamy dla Ciebie najnowszą i konkurencyjną cenę od chińskich producentów.Odwiedź stronę
ChemNet Mall
Dostawcy za 437-17-2 (0):
Usługa bazy danych Chemical CAS jest świadczona przez ChemIndex.com 