ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
403-15-6 4-Fluoro-3-methylbenzoic acid |
|
Nazwa produktu: | 4-Fluoro-3-methylbenzoic acid |
Angielska nazwa | 4-Fluoro-3-methylbenzoic acid;4-Fluoro-m-toluic acid;4-fluoro-3-methylbenzoate;3-methyl-4-Fluorobenzoic acid; |
MF | C8H6FO2 |
Masie cząsteczkowej | 153.131 |
InChI | InChI=1/C8H7FO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H,10,11)/p-1 |
Nr CAS | 403-15-6 |
Struktury molekularnej | |
Temperatura topnienia | 166-169℃ |
Temperatura wrzenia | 266.3°C at 760 mmHg |
Temperatura zapłonu | 114.9°C |
Ciśnienie pary | 0.00434mmHg at 25°C |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |