ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
388088-83-3 2-bromo-1-(3,5-dimetylo-1-benzotiofen-2-ylo)-1-etanon |
|
Nazwa produktu: | 2-bromo-1-(3,5-dimetylo-1-benzotiofen-2-ylo)-1-etanon |
Synonimy | 2-bromo-1-(3,5-dimetylo-1-benzotiofen-2-ylo)etanon; |
Angielska nazwa | 2-bromo-1-(3,5-dimethyl-1-benzothiophen-2-yl)-1-ethanone;2-bromo-1-(3,5-dimethyl-1-benzothiophen-2-yl)ethanone |
MF | C12H11BrOS |
Masie cząsteczkowej | 283.1841 |
InChI | InChI=1/C12H11BrOS/c1-7-3-4-11-9(5-7)8(2)12(15-11)10(14)6-13/h3-5H,6H2,1-2H3 |
Nr CAS | 388088-83-3 |
Struktury molekularnej | ![]() |
Gęstość | 1.488g/cm3 |
Temperatura topnienia | 125℃ |
Temperatura wrzenia | 378.5°C at 760 mmHg |
Współczynnik załamania | 1.655 |
Temperatura zapłonu | 182.7°C |
Ciśnienie pary | 6.26E-06mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R34##Causes burns.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |