ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
36919-03-6 Methyl pentafluorophenyl carbonate |
|
Nazwa produktu: | Methyl pentafluorophenyl carbonate |
Angielska nazwa | Methyl pentafluorophenyl carbonate;Pentafluorophenyl methyl carbonate |
MF | C8H3F5O3 |
Masie cząsteczkowej | 242.0996 |
InChI | InChI=1/C8H3F5O3/c1-15-8(14)16-7-5(12)3(10)2(9)4(11)6(7)13/h1H3 |
Nr CAS | 36919-03-6 |
Struktury molekularnej | |
Gęstość | 1.567g/cm3 |
Temperatura wrzenia | 207.5°C at 760 mmHg |
Współczynnik załamania | 1.422 |
Temperatura zapłonu | 77.3°C |
Ciśnienie pary | 0.224mmHg at 25°C |
Kody ryzyka | R22##Harmful if swallowed.||R36/38##Irritating to eyes and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |