Chemindex > 349-01-9
PL ▼
2,4-dinitro-5-fluorotoluene |
|
| Nazwa produktu: | 2,4-dinitro-5-fluorotoluene |
| Angielska nazwa | 2,4-dinitro-5-fluorotoluene;1-Fluoro-5-methyl-2,4-dinitrobenzene |
| MF | C7H5FN2O4 |
| Masie cząsteczkowej | 200.124 |
| InChI | InChI=1/C7H5FN2O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,1H3 |
| Nr CAS | 349-01-9 |
| Struktury molekularnej |  |
| Gęstość | 1.497g/cm3 |
| Temperatura topnienia | 82℃ |
| Temperatura wrzenia | 319°C at 760 mmHg |
| Współczynnik załamania | 1.575 |
| Temperatura zapłonu | 146.8°C |
| Ciśnienie pary | 0.000649mmHg at 25°C |
| Symbole zagrożenia |  T##Toxic:; |
| Kody ryzyka | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
| Bezpieczeństwo opis | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S38##In case of insufficient ventilation, wear suitable respiratory equipment.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jeśli planujesz zaopatrywać się w chemikalia z Chin, po prostu udaj się do centrum handlowego ChemNet, a my uzyskamy dla Ciebie najnowszą i konkurencyjną cenę od chińskich producentów.Odwiedź stronę
ChemNet Mall
Usługa bazy danych Chemical CAS jest świadczona przez ChemIndex.com 