ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
dimethyl fluoromalonate |
|
Nazwa produktu: | dimethyl fluoromalonate |
Angielska nazwa | dimethyl fluoromalonate;Fluoromalonic acid dimethyl ester;dimethyl fluoropropanedioate;2-Fluoro-malonic acid dimethyl ester |
MF | C5H7FO4 |
Masie cząsteczkowej | 150.1051 |
InChI | InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
Nr CAS | 344-14-9 |
Struktury molekularnej | |
Gęstość | 1.211g/cm3 |
Temperatura wrzenia | 140.3°C at 760 mmHg |
Współczynnik załamania | 1.382 |
Temperatura zapłonu | 38.4°C |
Ciśnienie pary | 6.18mmHg at 25°C |
Kody ryzyka | R34##Causes burns.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |