ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Harmine hydrochloride hydrate |
|
Nazwa produktu: | Harmine hydrochloride hydrate |
Angielska nazwa | Harmine hydrochloride hydrate;7-Methoxy-1-methyl-9H-pyrido[3,4-b]indole hydrochloride hydrate;Harmine hydrochlorid;Banisterine, Telepathine;7-methoxy-1-methyl-9H-beta-carbolin-9-ium chloride;Harmine Hydrochloride |
MF | C13H13ClN2O |
Masie cząsteczkowej | 248.7081 |
InChI | InChI=1/C13H12N2O.ClH/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;/h3-7,15H,1-2H3;1H |
Nr CAS | 343-27-1 |
EINECS | 206-443-8 |
Struktury molekularnej | |
Temperatura topnienia | 265-270℃ |
Temperatura wrzenia | 421.4°C at 760 mmHg |
Temperatura zapłonu | 139.8°C |
Ciśnienie pary | 6.42E-07mmHg at 25°C |
Symbole zagrożenia | Xn##Harmful:; |
Kody ryzyka | R40##Possible risks of irreversible effects.:; |
Bezpieczeństwo opis | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |