ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33904-03-9 2,4-dimethoxyphenyl isothiocyanate |
|
Nazwa produktu: | 2,4-dimethoxyphenyl isothiocyanate |
Angielska nazwa | 2,4-dimethoxyphenyl isothiocyanate; |
MF | C9H9NO2S |
Masie cząsteczkowej | 195.2383 |
InChI | InChI=1/C9H9NO2S/c1-11-7-3-4-8(10-6-13)9(5-7)12-2/h3-5H,1-2H3 |
Nr CAS | 33904-03-9 |
Struktury molekularnej | |
Gęstość | 1.12g/cm3 |
Temperatura topnienia | 51℃ |
Temperatura wrzenia | 331°C at 760 mmHg |
Współczynnik załamania | 1.537 |
Temperatura zapłonu | 154°C |
Ciśnienie pary | 0.000308mmHg at 25°C |
Symbole zagrożenia | Xn##Harmful:; |
Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |