ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-fluoro-6-metylonaftalen |
|
Nazwa produktu: | 2-fluoro-6-metylonaftalen |
Angielska nazwa | 2-fluoro-6-methylnaphthalene; |
MF | C11H9F |
Masie cząsteczkowej | 160.1876 |
InChI | InChI=1/C11H9F/c1-8-2-3-10-7-11(12)5-4-9(10)6-8/h2-7H,1H3 |
Nr CAS | 324-42-5 |
Struktury molekularnej | |
Gęstość | 1.112g/cm3 |
Temperatura topnienia | 72℃ |
Temperatura wrzenia | 247.5°C at 760 mmHg |
Współczynnik załamania | 1.594 |
Temperatura zapłonu | 84.5°C |
Ciśnienie pary | 0.0403mmHg at 25°C |
Symbole zagrożenia | Xi##Irritant:; |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |