ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306934-98-5 chlorek 2-(2-tienylo)-1,3-tiazola-4-karbonylu |
|
Nazwa produktu: | chlorek 2-(2-tienylo)-1,3-tiazola-4-karbonylu |
Synonimy | chlorek 2-tiofen-2-ylo-1,3-tiazole-4-karbonylu; |
Angielska nazwa | 2-(2-thienyl)-1,3-thiazole-4-carbonyl chloride;2-thiophen-2-yl-1,3-thiazole-4-carbonyl chloride |
MF | C8H4ClNOS2 |
Masie cząsteczkowej | 229.7065 |
InChI | InChI=1/C8H4ClNOS2/c9-7(11)5-4-13-8(10-5)6-2-1-3-12-6/h1-4H |
Nr CAS | 306934-98-5 |
Struktury molekularnej | ![]() |
Gęstość | 1.498g/cm3 |
Temperatura topnienia | 90℃ |
Temperatura wrzenia | 371.6°C at 760 mmHg |
Współczynnik załamania | 1.65 |
Temperatura zapłonu | 178.5°C |
Ciśnienie pary | 1.02E-05mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R34##Causes burns.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |