ChemIndex - Bezpłatna baza danych CAS chemikaliówChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Arecoline hydrobromide |
|
Nazwa produktu: | Arecoline hydrobromide |
Angielska nazwa | Arecoline hydrobromide;methyl 1,2,5,6-tetrahydro-1-methyl-3-pyridinecarboxylate hydrobromide;methyl 1-methyl-1,2,5,6-tetrahydropyridine-3-carboxylate hydrobromide (1:1);1-Methyl-1,2,5,6-tetrahydro-3-pyridinecarboxylic acid methyl ester hydrobromide;Arecoline HBr |
MF | C8H14BrNO2 |
Masie cząsteczkowej | 236.1063 |
InChI | InChI=1/C8H13NO2.BrH/c1-9-5-3-4-7(6-9)8(10)11-2;/h4H,3,5-6H2,1-2H3;1H |
Nr CAS | 300-08-3 |
EINECS | 206-087-3 |
Struktury molekularnej | |
Temperatura topnienia | 171-174℃ |
Temperatura wrzenia | 209°C at 760 mmHg |
Temperatura zapłonu | 81.1°C |
Ciśnienie pary | 0.208mmHg at 25°C |
Symbole zagrożenia | Xn##Harmful:; |
Kody ryzyka | R22:; |
Bezpieczeństwo opis | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S38##In case of insufficient ventilation, wear suitable respiratory equipment.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |