ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
275-51-4 Azulene |
|
Nazwa produktu: | Azulene |
Angielska nazwa | Azulene;Bicyclo[5.3.0]decapentaene;Azunamic;Cyclopentacycloheptene;Bicyclo(5.3.0)-deca-2,4,6,8,10-pentaene;Bicyclo(5.3.0)-1,3,5,7,9-decapentaene;EINECS |
MF | C10H8 |
Masie cząsteczkowej | 128.1705 |
InChI | InChI=1/C10H8/c1-2-5-9-7-4-8-10(9)6-3-1/h1-8H |
Nr CAS | 275-51-4 |
EINECS | 205-993-6 |
Struktury molekularnej | ![]() |
Gęstość | 1.037g/cm3 |
Temperatura topnienia | 99-101℃ |
Temperatura wrzenia | 220.7°C at 760 mmHg |
Współczynnik załamania | 1.632 |
Temperatura zapłonu | 76.7°C |
Ciśnienie pary | 0.165mmHg at 25°C |
Bezpieczeństwo opis | S24/25##Avoid contact with skin and eyes.:; |
MSDS |