ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
229-87-8 Phenanthridine |
|
Nazwa produktu: | Phenanthridine |
Angielska nazwa | Phenanthridine;Phenanthridine;3,4-Benzoquinoline;Phenanthridine, (Benzo[c]quinoline) |
MF | C13H9N |
Masie cząsteczkowej | 179.2173 |
InChI | InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
Nr CAS | 229-87-8 |
EINECS | 205-934-4 |
Struktury molekularnej | |
Gęstość | 1.187g/cm3 |
Temperatura topnienia | 104-107℃ |
Temperatura wrzenia | 340.8°C at 760 mmHg |
Współczynnik załamania | 1.726 |
Temperatura zapłonu | 155.9°C |
Ciśnienie pary | 0.000166mmHg at 25°C |
Symbole zagrożenia | Xn##Harmful:; |
Kody ryzyka | R40##Possible risks of irreversible effects.:; |
Bezpieczeństwo opis | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |